Benzaldehyde,4-(dimethylamino)-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazone
![Benzaldehyde,4-(dimethylamino)-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazone Structure](https://image.chemsrc.com/caspic/217/2143-98-8.png)
Benzaldehyde,4-(dimethylamino)-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazone structure
|
Common Name | Benzaldehyde,4-(dimethylamino)-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazone | ||
|---|---|---|---|---|
| CAS Number | 2143-98-8 | Molecular Weight | 294.39400 | |
| Density | 1g/cm3 | Boiling Point | 435.7ºC at 760mmHg | |
| Molecular Formula | C18H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 435.7ºC at 760mmHg |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.39400 |
| Flash Point | 217.3ºC |
| Exact Mass | 294.18400 |
| PSA | 31.20000 |
| LogP | 3.27160 |
| Vapour Pressure | 8.6E-08mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | UPHRISURECPMEH-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=NN=Cc2ccc(N(C)C)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 5 | |
CAS#:100-10-7![Hydrazinecarboxamide,2-[[4-(dimethylamino)phenyl]methylene] Structure](https://image.chemsrc.com/caspic/488/2929-82-0.png)
CAS#:2929-82-0![Hydrazinecarbothioamide,2-[[4-(dimethylamino)phenyl]methylene] Structure](https://image.chemsrc.com/caspic/036/2929-81-9.png)
CAS#:2929-81-9![N-[4-Dimethylamino-benzyliden]-4-rhodan-anilin Structure](https://image.chemsrc.com/caspic/295/3378-57-2.png)
CAS#:3378-57-2
CAS#:41463-93-8
CAS#:27346-89-0
CAS#:64-17-5
CAS#:7647-01-0![4-[[2-[[4-(dimethylamino)phenyl]methyl]hydrazinyl]methyl]-N,N-dimethylaniline Structure](https://image.chemsrc.com/caspic/225/102395-16-4.png)
CAS#:102395-16-4
CAS#:1931-49-3![4-[(fluoren-9-ylidenehydrazinylidene)methyl]-N,N-dimethyl-aniline structure](https://image.chemsrc.com/caspic/206/75159-08-9.png)
CAS#:75159-08-9This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-dimethylaminobenzaldehyde azine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2143-98-8? |
| A: Chinese name of 2143-98-8 is 2143-98-8. |
| Q: What English synonyms does 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline have? |
| A: English synonyms of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline: p-dimethylaminobenzaldehyde azine. |
| Q: What is the molecular weight of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline? |
| A: Molecular weight of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline is 294.39400. |
| Q: What is the LogP of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline? |
| A: LogP of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline is 3.27160. |
| Q: What is the SMILES notation of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline? |
| A: SMILES notation of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline is CN(C)c1ccc(C=NN=Cc2ccc(N(C)C)cc2)cc1. |
| Q: What is the boiling point of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline? |
| A: Boiling point of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline is 435.7ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline? |
| A: Polar surface area (PSA) of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline is 31.20000. |
| Q: What is the English name of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline? |
| A: The English name of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline is 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline. |
| Q: What are the upstream materials of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline? |
| A: Related upstream materials(CAS) of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline: 100-10-7;2929-82-0;2929-81-9;3378-57-2;41463-93-8;27346-89-0;64-17-5;7647-01-0;102395-16-4. |
| Q: What is the InChIKey of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline? |
| A: InChIKey of 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline is UPHRISURECPMEH-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |