Benzaldehyde,4-(dimethylamino)-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazone structure
|
Common Name | Benzaldehyde,4-(dimethylamino)-, 2-[[4-(dimethylamino)phenyl]methylene]hydrazone | ||
|---|---|---|---|---|
| CAS Number | 2143-98-8 | Molecular Weight | 294.39400 | |
| Density | 1g/cm3 | Boiling Point | 435.7ºC at 760mmHg | |
| Molecular Formula | C18H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | 4-[(Z)-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 435.7ºC at 760mmHg |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.39400 |
| Flash Point | 217.3ºC |
| Exact Mass | 294.18400 |
| PSA | 31.20000 |
| LogP | 3.27160 |
| Vapour Pressure | 8.6E-08mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | UPHRISURECPMEH-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=NN=Cc2ccc(N(C)C)cc2)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
| p-dimethylaminobenzaldehyde azine |