4-METHYL-N-(4-METHYL-BENZYLIDENE)BENZENESULFONAMIDE
4-METHYL-N-(4-METHYL-BENZYLIDENE)BENZENESULFONAMIDE structure
|
Common Name | 4-METHYL-N-(4-METHYL-BENZYLIDENE)BENZENESULFONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 75159-10-3 | Molecular Weight | 273.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15NO2S |
|---|---|
| Molecular Weight | 273.35000 |
| Exact Mass | 273.08200 |
| PSA | 54.88000 |
| LogP | 4.19200 |
| InChIKey | CEZQVKAFKQRFDG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=NS(=O)(=O)c2ccc(C)cc2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 4 | |
CAS#:104-87-0
CAS#:70-55-3
CAS#:589-18-4
CAS#:127-65-1![4-methyl-N-[1-(4-methylphenyl)but-3-enyl]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/381/243671-17-2.png)
CAS#:243671-17-2
CAS#:1058-14-6
CAS#:3395-83-3![4-methyl-N-[(4-methylphenyl)methyl]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/191/10504-92-4.png)
CAS#:10504-92-4![2-[2-(4-methylphenyl)ethenyl]quinoline structure](https://image.chemsrc.com/caspic/058/58702-62-8.png)
CAS#:58702-62-8
CAS#:62506-80-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-MeC6H4CH=NTs |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: CAS number of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide is 75159-10-3. |
| Q: What is the polar surface area (PSA) of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: Polar surface area (PSA) of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide is 54.88000. |
| Q: What is the English name of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: The English name of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide is 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide. |
| Q: What is the InChIKey of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: InChIKey of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide is CEZQVKAFKQRFDG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: SMILES notation of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide is Cc1ccc(C=NS(=O)(=O)c2ccc(C)cc2)cc1. |
| Q: What English synonyms does 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide have? |
| A: English synonyms of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide: p-MeC6H4CH=NTs. |
| Q: What are the upstream materials of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: Related upstream materials(CAS) of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide: 104-87-0;70-55-3;589-18-4;127-65-1;243671-17-2;1058-14-6;3395-83-3;10504-92-4. |
| Q: What is the molecular weight of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: Molecular weight of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide is 273.35000. |
| Q: What is the LogP of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: LogP of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide is 4.19200. |
| Q: What are the downstream products of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide? |
| A: Related downstream products(CAS) of 4-methyl-N-[(4-methylphenyl)methylidene]benzenesulfonamide: 243671-17-2;10504-92-4;58702-62-8;62506-80-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |