ethyl 2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetate structure
|
Common Name | ethyl 2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 75238-44-7 | Molecular Weight | 323.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H17NO4 |
|---|---|
| Molecular Weight | 323.34300 |
| Exact Mass | 323.11600 |
| PSA | 68.39000 |
| LogP | 3.49270 |
| InChIKey | GEOTYZHKCQCORI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)c1c[nH]c2ccc(OCc3ccccc3)cc12 |
|
~%
ethyl 2-oxo-2-(... CAS#:75238-44-7 |
| Literature: Journal of the American Chemical Society, , vol. 129, # 26 p. 8328 - 8332 |
|
~%
ethyl 2-oxo-2-(... CAS#:75238-44-7 |
| Literature: Journal of the American Chemical Society, , vol. 129, # 26 p. 8328 - 8332 |
|
~%
ethyl 2-oxo-2-(... CAS#:75238-44-7 |
| Literature: Chemische Berichte, , vol. 91, p. 242 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| AmbotzXAA1090 |