1-Phenyl-5H-pyrido[4,3-b]indol-3-amine acetate (1:1) structure
|
Common Name | 1-Phenyl-5H-pyrido[4,3-b]indol-3-amine acetate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 75240-16-3 | Molecular Weight | 319.35700 | |
| Density | N/A | Boiling Point | 558.2ºC at 760 mmHg | |
| Molecular Formula | C19H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.7ºC | |
| Name | 1-Phenyl-5H-pyrido[4,3-b]indol-3-amine acetate (1:1) |
|---|
| Boiling Point | 558.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.35700 |
| Flash Point | 325.7ºC |
| Exact Mass | 319.13200 |
| PSA | 92.73000 |
| LogP | 3.98630 |
| InChIKey | HJJKUZBZMFJEAC-UHFFFAOYSA-N |
| SMILES | CC(=O)O.Nc1cc2[nH]c3ccccc3c2c(-c2ccccc2)n1 |
|
~%
1-Phenyl-5H-pyr... CAS#:75240-16-3 |
| Literature: Takeda; Shudo; Okamoto; Kosuge Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 5 p. 1280 - 1285 |
|
~%
1-Phenyl-5H-pyr... CAS#:75240-16-3 |
| Literature: Takeda; Shudo; Okamoto; Kosuge Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 5 p. 1280 - 1285 |
|
~10%
1-Phenyl-5H-pyr... CAS#:75240-16-3 |
| Literature: Takeda; Shudo; Okamoto; Kosuge Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 5 p. 1280 - 1285 |