(S)-2-(Benzyloxycarbonylamino)-3-butenoic acid methyl ester structure
|
Common Name | (S)-2-(Benzyloxycarbonylamino)-3-butenoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 75266-40-9 | Molecular Weight | 249.262 | |
| Density | 1.153 | Boiling Point | 387.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H15NO4 | Melting Point | 35-36ºC | |
| MSDS | N/A | Flash Point | 188.4±27.9 °C | |
| Name | (S)-Methyl 2-(((benzyloxy)carbonyl)amino)but-3-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153 |
|---|---|
| Boiling Point | 387.9±42.0 °C at 760 mmHg |
| Melting Point | 35-36ºC |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.262 |
| Flash Point | 188.4±27.9 °C |
| Exact Mass | 249.100113 |
| PSA | 64.63000 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | YDGRSOXTMWVLOJ-NSHDSACASA-N |
| SMILES | C=CC(NC(=O)OCc1ccccc1)C(=O)OC |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl (2S)-2-(phenylmethoxycarbonylamino)but-3-enoate |
| Methyl (2S)-2-{[(benzyloxy)carbonyl]amino}-3-butenoate |
| (S)-2-(Benzyloxycarbonylamino)-3-butenoic acid methyl ester |