Phenylacetyl-Coenzyme A structure
|
Common Name | Phenylacetyl-Coenzyme A | ||
|---|---|---|---|---|
| CAS Number | 7532-39-0 | Molecular Weight | 885.66700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H42N7O17P3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Phenylacetyl-Coenzyme APhenylacetyl CoA is an acceptor oxidoreductase. Phenylacetyl CoA is a membrane-bound molybdenum–iron–sulfur enzyme involved in anaerobic metabolism of phenylalanine in the denitrifying bacterium Thauera aromatica[1]. |
| Name | phenylacetyl-CoA |
|---|
| Description | Phenylacetyl CoA is an acceptor oxidoreductase. Phenylacetyl CoA is a membrane-bound molybdenum–iron–sulfur enzyme involved in anaerobic metabolism of phenylalanine in the denitrifying bacterium Thauera aromatica[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H42N7O17P3S |
|---|---|
| Molecular Weight | 885.66700 |
| Exact Mass | 885.15700 |
| PSA | 418.36000 |
| LogP | 1.27040 |
| InChIKey | ZIGIFDRJFZYEEQ-CECATXLMSA-N |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)(O)O)C(O)C(=O)NCCC(=O)NCCSC(=O)Cc1ccccc1 |