3-[Bis(2-hydroxyethyl)amino]propyl-triethoxysilane solution structure
|
Common Name | 3-[Bis(2-hydroxyethyl)amino]propyl-triethoxysilane solution | ||
|---|---|---|---|---|
| CAS Number | 7538-44-5 | Molecular Weight | 309.47400 | |
| Density | 0.92 | Boiling Point | 380.2ºC at 760 mmHg | |
| Molecular Formula | C13H31NO5Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 24°C | |
| Symbol |
GHS02 |
Signal Word | Warning | |
| Name | bis(2-hydroxyethyl)-3-aminopropyltriethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.92 |
|---|---|
| Boiling Point | 380.2ºC at 760 mmHg |
| Molecular Formula | C13H31NO5Si |
| Molecular Weight | 309.47400 |
| Flash Point | 24°C |
| Exact Mass | 309.19700 |
| PSA | 71.39000 |
| LogP | 0.71150 |
| Index of Refraction | 1.4090 |
| InChIKey | IYAYDWLKTPIEDC-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCN(CCO)CCO)(OCC)OCC |
| Symbol |
GHS02 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R10 |
| Safety Phrases | S26 |
| RIDADR | UN 1170 3/PG 3 |
| WGK Germany | 1 |
|
Amino ethyl-functionalized nanoporous silica as a novel fiber coating for solid-phase microextraction.
Anal. Chim. Acta 646(1-2) , 1-5, (2009) Nanoporous silica (SBA-15) was prepared and functionalized with 3-[Bis(2-hydroxyethyl)amino] propyl-triethoxysilane (HPTES) to be used as a highly porous fiber coating material for solid-phase microex... |
| MFCD00053352 |
| EINECS 231-408-9 |