2-ISOPROPYL-6-NITROPHENOL structure
|
Common Name | 2-ISOPROPYL-6-NITROPHENOL | ||
|---|---|---|---|---|
| CAS Number | 7545-71-3 | Molecular Weight | 181.18900 | |
| Density | 1.209g/cm3 | Boiling Point | 237.1ºC at 760 mmHg | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.4ºC | |
| Name | 2-nitro-6-propan-2-ylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 237.1ºC at 760 mmHg |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.18900 |
| Flash Point | 97.4ºC |
| Exact Mass | 181.07400 |
| PSA | 66.05000 |
| LogP | 2.94700 |
| Index of Refraction | 1.566 |
| InChIKey | RRFSVDKJKYCCEK-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc([N+](=O)[O-])c1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2908999090 |
|
~%
2-ISOPROPYL-6-N... CAS#:7545-71-3 |
| Literature: Fileti Gazzetta Chimica Italiana, 1886 , vol. 16, p. 114 |
|
~%
2-ISOPROPYL-6-N... CAS#:7545-71-3 |
| Literature: Fileti Gazzetta Chimica Italiana, 1886 , vol. 16, p. 114 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 6-Nitro-2-isopropyl-phenol |
| 2-Nitro-6-isopropylphenol |
| 3-Nitro-2-oxy-1-isopropyl-benzol |
| 2-isopropyl-6-nitrophenol |
| 6-isopropyl-2-nitrophenol |