1H-Isoindole-1,3(2H)-dione,2-(4-chloro-2-nitrophenyl)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(4-chloro-2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 75458-16-1 | Molecular Weight | 302.66900 | |
| Density | 1.588g/cm3 | Boiling Point | 496.1ºC at 760 mmHg | |
| Molecular Formula | C14H7ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.9ºC | |
| Name | 2-(4-chloro-2-nitrophenyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.588g/cm3 |
|---|---|
| Boiling Point | 496.1ºC at 760 mmHg |
| Molecular Formula | C14H7ClN2O4 |
| Molecular Weight | 302.66900 |
| Flash Point | 253.9ºC |
| Exact Mass | 302.00900 |
| PSA | 83.20000 |
| LogP | 3.63700 |
| Index of Refraction | 1.698 |
| InChIKey | XEKNVZVYYMZIFM-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(Cl)cc1[N+](=O)[O-] |
|
~79%
1H-Isoindole-1,... CAS#:75458-16-1 |
| Literature: Amenta, Donna S.; Mallory, Frank B. Journal of Organic Chemistry, 1980 , vol. 45, # 26 p. 5236 - 5238 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Chlor-2-phthalimido-nitrobenzol |
| 1-N-phthalimido-2-nitro-4-chlorobenzene |
| 5-Chloro-2-phthalimidonitrobenzene |
| CL 6502 |