1-[(E)-2-bromo-2-nitro-ethenyl]-4-nitro-benzene structure
|
Common Name | 1-[(E)-2-bromo-2-nitro-ethenyl]-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 7559-38-8 | Molecular Weight | 273.04000 | |
| Density | 1.802g/cm3 | Boiling Point | 345.1ºC at 760 mmHg | |
| Molecular Formula | C8H5BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.5ºC | |
| Name | 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.802g/cm3 |
|---|---|
| Boiling Point | 345.1ºC at 760 mmHg |
| Molecular Formula | C8H5BrN2O4 |
| Molecular Weight | 273.04000 |
| Flash Point | 162.5ºC |
| Exact Mass | 271.94300 |
| PSA | 91.64000 |
| LogP | 3.61120 |
| Index of Refraction | 1.686 |
| InChIKey | NKEZGXYHICIZSU-YVMONPNESA-N |
| SMILES | O=[N+]([O-])C(Br)=Cc1ccc([N+](=O)[O-])cc1 |
|
~61%
1-[(E)-2-bromo-... CAS#:7559-38-8 |
| Literature: Romashov, Leonid V.; Khomutova, Yulya A.; Danilenko, Vitaliy M.; Ioffe, Sema L.; Lesiv, Alexey V. Synthesis, 2010 , # 3 p. 407 - 414 |
|
~%
1-[(E)-2-bromo-... CAS#:7559-38-8 |
| Literature: Devlin,C.J.; Walker,B.J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 1428 - 1431 |
| 1-(2-bromo-2-nitrovinyl)-4-nitrobenzene |
| 1-bromo-1-nitro-2-(4-nitrophenyl)ethene |
| 2-Brom-2-nitro-1-(4-nitro-phenyl)-ethylen |
| Benzene,1-(2-bromo-2-nitroethenyl)-4-nitro |