1-[(E)-2-bromo-2-nitro-ethenyl]-4-nitro-benzene
![1-[(E)-2-bromo-2-nitro-ethenyl]-4-nitro-benzene Structure](https://image.chemsrc.com/caspic/083/7559-38-8.png)
1-[(E)-2-bromo-2-nitro-ethenyl]-4-nitro-benzene structure
|
Common Name | 1-[(E)-2-bromo-2-nitro-ethenyl]-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 7559-38-8 | Molecular Weight | 273.04000 | |
| Density | 1.802g/cm3 | Boiling Point | 345.1ºC at 760 mmHg | |
| Molecular Formula | C8H5BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.802g/cm3 |
|---|---|
| Boiling Point | 345.1ºC at 760 mmHg |
| Molecular Formula | C8H5BrN2O4 |
| Molecular Weight | 273.04000 |
| Flash Point | 162.5ºC |
| Exact Mass | 271.94300 |
| PSA | 91.64000 |
| LogP | 3.61120 |
| Index of Refraction | 1.686 |
| InChIKey | NKEZGXYHICIZSU-YVMONPNESA-N |
| SMILES | O=[N+]([O-])C(Br)=Cc1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~61%
1-[(E)-2-bromo-... CAS#:7559-38-8 |
| Literature: Romashov, Leonid V.; Khomutova, Yulya A.; Danilenko, Vitaliy M.; Ioffe, Sema L.; Lesiv, Alexey V. Synthesis, 2010 , # 3 p. 407 - 414 |
|
~%
1-[(E)-2-bromo-... CAS#:7559-38-8 |
| Literature: Devlin,C.J.; Walker,B.J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 1428 - 1431 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 6 | |
CAS#:555-16-8
CAS#:563-70-2
CAS#:10035-10-6
CAS#:7697-37-2
CAS#:7782-77-6
CAS#:46417-99-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(2-bromo-2-nitrovinyl)-4-nitrobenzene |
| 1-bromo-1-nitro-2-(4-nitrophenyl)ethene |
| 2-Brom-2-nitro-1-(4-nitro-phenyl)-ethylen |
| Benzene,1-(2-bromo-2-nitroethenyl)-4-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: Related downstream products(CAS) of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene: 555-16-8;563-70-2;10035-10-6;7697-37-2;7782-77-6;46417-99-6. |
| Q: What are the upstream materials of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: Related upstream materials(CAS) of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene: 3156-41-0;55446-62-3. |
| Q: What is the SMILES notation of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: SMILES notation of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene is O=[N+]([O-])C(Br)=Cc1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular weight of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: Molecular weight of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene is 273.04000. |
| Q: What is the boiling point of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: Boiling point of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene is 345.1ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: Polar surface area (PSA) of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene is 91.64000. |
| Q: What is the InChIKey of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: InChIKey of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene is NKEZGXYHICIZSU-YVMONPNESA-N. |
| Q: What is the molecular formula of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: Molecular formula of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene is C8H5BrN2O4. |
| Q: What is the CAS number of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene? |
| A: CAS number of 1-[(E)-2-bromo-2-nitroethenyl]-4-nitrobenzene is 7559-38-8. |
| Q: What is the Chinese name of 7559-38-8? |
| A: Chinese name of 7559-38-8 is 7559-38-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |