n-pentafluorobenzoylimidazole
Modify Date: 2026-06-25 21:31:45
n-pentafluorobenzoylimidazole structure
|
Common Name | n-pentafluorobenzoylimidazole | ||
|---|---|---|---|---|
| CAS Number | 75641-06-4 | Molecular Weight | 262.13600 | |
| Density | 1.59g/cm3 | Boiling Point | 372.3ºC at 760mmHg | |
| Molecular Formula | C10H3F5N2O | Melting Point | 55 °C | |
| MSDS | N/A | Flash Point | 179ºC | |
| Name | imidazol-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760mmHg |
| Melting Point | 55 °C |
| Molecular Formula | C10H3F5N2O |
| Molecular Weight | 262.13600 |
| Flash Point | 179ºC |
| Exact Mass | 262.01700 |
| PSA | 34.89000 |
| LogP | 2.26710 |
| InChIKey | DOLREFXBQXCDOR-UHFFFAOYSA-N |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)n1ccnc1 |
| Storage condition | Keep Cold |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| EINECS 278-285-8 |
| imidazolyl 2,3,4,5,6-pentafluorophenyl ketone |
| N-Pentafluorobenzoylimidazole |
| 1-Pentafluorobenzoyl-1H-imidazole |
| MFCD00014500 |
| 1H-Imidazole,1-(pentafluorobenzoyl) |