1-[2-Amino-4-(benzyloxy)-5-methoxyphenyl]ethanone structure
|
Common Name | 1-[2-Amino-4-(benzyloxy)-5-methoxyphenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 75665-73-5 | Molecular Weight | 271.311 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 450.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.1±23.7 °C | |
| Name | 1-(2-amino-5-methoxy-4-phenylmethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.4±40.0 °C at 760 mmHg |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.311 |
| Flash Point | 205.1±23.7 °C |
| Exact Mass | 271.120850 |
| PSA | 61.55000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | ODOYPGHNQKAPBX-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)=O)c(N)cc1OCc1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
|
~97%
1-[2-Amino-4-(b... CAS#:75665-73-5 |
| Literature: XI, Dr. Ning Patent: US2012/219522 A1, 2012 ; Location in patent: Page/Page column 28 ; |
|
~79%
1-[2-Amino-4-(b... CAS#:75665-73-5 |
| Literature: KIRIN BEER KABUSHIKI KAISHA Patent: EP1153920 A1, 2001 ; |
|
~70%
Detail
|
| Literature: Zeneca Limited; Zeneca Pharma S.A. Patent: US6514971 B1, 2003 ; US 6514971 B1 |
|
Detail
|
| Literature: Hennequin, Laurent Francois Andre Patent: US2003/212055 A1, 2003 ; |
|
~%
1-[2-Amino-4-(b... CAS#:75665-73-5 |
| Literature: MAX-PLANCK-GESELLSCHAFT ZUR FOeRDERUNG DER WISSENSCHAFTEN E.V.; ULLRICH, Axel; TORKA, Robert; ZHANG, Yixiang; KERI, Gyoergy; OeRFI, Laszlo; SZABADKAI, Istvan Patent: WO2011/45084 A1, 2011 ; WO 2011/045084 A1 |
|
~%
1-[2-Amino-4-(b... CAS#:75665-73-5 |
| Literature: MAX-PLANCK-GESELLSCHAFT ZUR FOeRDERUNG DER WISSENSCHAFTEN E.V.; ULLRICH, Axel; TORKA, Robert; ZHANG, Yixiang; KERI, Gyoergy; OeRFI, Laszlo; SZABADKAI, Istvan Patent: WO2011/45084 A1, 2011 ; WO 2011/045084 A1 |
|
~%
1-[2-Amino-4-(b... CAS#:75665-73-5 |
| Literature: MAX-PLANCK-GESELLSCHAFT ZUR FOeRDERUNG DER WISSENSCHAFTEN E.V.; ULLRICH, Axel; TORKA, Robert; ZHANG, Yixiang; KERI, Gyoergy; OeRFI, Laszlo; SZABADKAI, Istvan Patent: WO2011/45084 A1, 2011 ; WO 2011/045084 A1 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethanone, 1-[2-amino-5-methoxy-4-(phenylmethoxy)phenyl]- |
| 1-[2-Amino-4-(benzyloxy)-5-methoxyphenyl]ethanone |
| 6-amino-3-methoxy-4-benzyloxyacetophenone |
| 2-amino-4-benzyloxy-5-methoxyacetophenone |