2',4'-Dihydroxy-4,6'-diMethoxydihydrochalcone structure
|
Common Name | 2',4'-Dihydroxy-4,6'-diMethoxydihydrochalcone | ||
|---|---|---|---|---|
| CAS Number | 75679-58-2 | Molecular Weight | 302.32 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 503.5±29.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.7±17.8 °C | |
Use of 2',4'-Dihydroxy-4,6'-diMethoxydihydrochalcone2',4'-Dihydroxy-4,6'-diMethoxydihydrochalcone is a dihydrochalcone compound isolated from Iryanthera juruensis Warb. 2',4'-Dihydroxy-4,6'-diMethoxydihydrochalcone is a major cytotoxic metabolite when tested against a panel of cancer cell lines[1]. |
| Name | 1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-methoxyphenyl)-1-propanone |
|---|---|
| Synonym | More Synonyms |
| Description | 2',4'-Dihydroxy-4,6'-diMethoxydihydrochalcone is a dihydrochalcone compound isolated from Iryanthera juruensis Warb. 2',4'-Dihydroxy-4,6'-diMethoxydihydrochalcone is a major cytotoxic metabolite when tested against a panel of cancer cell lines[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 503.5±29.0 °C at 760 mmHg |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32 |
| Flash Point | 184.7±17.8 °C |
| Exact Mass | 302.115417 |
| PSA | 75.99000 |
| LogP | 4.27 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | SGAQUVXWXIVPKX-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCC(=O)c2c(O)cc(O)cc2OC)cc1 |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: Estrogenic potency in human MCF7 BUS cells assessed as drug level inducing maximal ce...
Source: ChEMBL
Target: MCF7
External Id: CHEMBL940092
|
|
Name: Cytotoxicity against BALB/c mouse 3T3 cells
Source: ChEMBL
Target: NIH3T3
External Id: CHEMBL936285
|
|
Name: Cytotoxicity against human H460 cells
Source: ChEMBL
Target: NCI-H460
External Id: CHEMBL936286
|
|
Name: Cytotoxicity against human DU145 cells
Source: ChEMBL
Target: DU-145
External Id: CHEMBL1057825
|
|
Name: Proliferative effect in human MCF7 BUS cells assessed as ratio of increase in cell nu...
Source: ChEMBL
Target: MCF7
External Id: CHEMBL940093
|
|
Name: Proliferative effect in human MCF7 BUS cells assessed as increase in cell number rela...
Source: ChEMBL
Target: MCF7
External Id: CHEMBL940094
|
|
Name: Cytotoxicity against human H460 cells
Source: ChEMBL
Target: NCI-H460
External Id: CHEMBL1057823
|
| 2',4'-Dihydroxy-4,6'-dimethoxydihydrochalcone |
| 1-(2,4-Dihydroxy-6-methoxy-phenyl)-3-(4-methoxy-phenyl)-propan-1-one |
| 1-(2,4-Dihydroxy-6-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-one |
| .2',4'-Dihydroxy-4,6'-dimethoxydihydrochalcone |
| 1-(2,4-Dihydroxy-6-methoxyphenyl)-3-(4-methoxyphenyl)-1-propanone |
| .4′,6′-dihydroxy-2′,4-dimethoxydihydrochalcone |
| 2′,4′-dihydroxy-4,6′-dimethoxydihydrochalcone |
| .2',4'-dihydroxy-4',6'-dimethoxydihydrochalcone |