[2-(3-pyridinyl)ethylidene-1,1]bis(phosphonic acid) structure
|
Common Name | [2-(3-pyridinyl)ethylidene-1,1]bis(phosphonic acid) | ||
|---|---|---|---|---|
| CAS Number | 75755-10-1 | Molecular Weight | 267.11300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11NO6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-phosphono-2-pyridin-3-ylethyl)phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H11NO6P2 |
|---|---|
| Molecular Weight | 267.11300 |
| Exact Mass | 267.00600 |
| PSA | 147.57000 |
| LogP | 0.30560 |
| InChIKey | KZMOFWIRXNQJET-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)C(Cc1cccnc1)P(=O)(O)O |
|
~%
[2-(3-pyridinyl... CAS#:75755-10-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 47, # 2 p. 375 - 384 |
|
~%
[2-(3-pyridinyl... CAS#:75755-10-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 47, # 2 p. 375 - 384 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| deoxyrisedronic acid |
| Risedronate related compound C |
| UNII-KU59Z0XVL4 |