1H-Isoindole-1,3(2H)-dione,2-[2-(2-bromophenyl)ethyl] structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-[2-(2-bromophenyl)ethyl] | ||
|---|---|---|---|---|
| CAS Number | 75767-95-2 | Molecular Weight | 330.17600 | |
| Density | 1.521g/cm3 | Boiling Point | 454.5ºC at 760mmHg | |
| Molecular Formula | C16H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.7ºC | |
| Name | 2-[2-(2-bromophenyl)ethyl]isoindole-1,3-dione |
|---|
| Density | 1.521g/cm3 |
|---|---|
| Boiling Point | 454.5ºC at 760mmHg |
| Molecular Formula | C16H12BrNO2 |
| Molecular Weight | 330.17600 |
| Flash Point | 228.7ºC |
| Exact Mass | 329.00500 |
| PSA | 37.38000 |
| LogP | 3.22570 |
| Index of Refraction | 1.649 |
| InChIKey | YVEPJFHKKMJJSP-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1ccccc1Br |
|
~80%
1H-Isoindole-1,... CAS#:75767-95-2 |
| Literature: Bradsher, Charles K.; Hunt, David A. Journal of Organic Chemistry, 1981 , vol. 46, # 2 p. 327 - 330 |