Phosphonium triphenyl ([phenylmethoxy]methyl)-chloride structure
|
Common Name | Phosphonium triphenyl ([phenylmethoxy]methyl)-chloride | ||
|---|---|---|---|---|
| CAS Number | 75772-01-9 | Molecular Weight | 418.89500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24ClOP | Melting Point | 168-174°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenyl(phenylmethoxymethyl)phosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 168-174°C |
|---|---|
| Molecular Formula | C26H24ClOP |
| Molecular Weight | 418.89500 |
| Exact Mass | 418.12500 |
| PSA | 22.82000 |
| LogP | 2.15880 |
| InChIKey | GJPGLLAXZTYTFW-UHFFFAOYSA-M |
| SMILES | [Cl-].c1ccc(COC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
|
~92%
Phosphonium tri... CAS#:75772-01-9 |
| Literature: Barton, Derek H. R.; Gero, S.D.; Cleophax, Jeannine; Machado, Antonio Salustiano; Quiclet-Sire, Beatrice Journal of the Chemical Society, Chemical Communications, 1988 , # 17 p. 1184 - 1186 |
|
~%
Phosphonium tri... CAS#:75772-01-9 |
| Literature: Pernak; Jedraszczyk; Krysinski Die Pharmazie, 1987 , vol. 42, # 10 p. 703 - 704 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| benzyloxymethylenetriphenylphosphonium chloride |
| Benzyloxymethyltriphenylphosphonium chloride |