K-P-P-T-P-P-P-E-P-E-T structure
|
Common Name | K-P-P-T-P-P-P-E-P-E-T | ||
|---|---|---|---|---|
| CAS Number | 75813-50-2 | Molecular Weight | 1189.31000 | |
| Density | 1.416g/cm3 | Boiling Point | 1574ºC at 760 mmHg | |
| Molecular Formula | C54H84N12O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 905.7ºC | |
Use of K-P-P-T-P-P-P-E-P-E-TLys-Pro-Pro-Thr-Pro-Pro-Pro-Glu-Pro-Glu-Thr is a undecapeptide, corresponding to the carboxy terminus of simian virus 40 large T antigen. Lys-Pro-Pro-Thr-Pro-Pro-Pro-Glu-Pro-Glu-Thr can be targeted by antibodies secreted from three mouse hybridomas, designated KT1, KT3, and KT4, produced antibodies that immunoprecipitated large T antigen[1][2]. |
| Name | h-lys-pro-pro-thr-pro-pro-pro-glu-pro-glu-thr-oh |
|---|---|
| Synonym | More Synonyms |
| Description | Lys-Pro-Pro-Thr-Pro-Pro-Pro-Glu-Pro-Glu-Thr is a undecapeptide, corresponding to the carboxy terminus of simian virus 40 large T antigen. Lys-Pro-Pro-Thr-Pro-Pro-Pro-Glu-Pro-Glu-Thr can be targeted by antibodies secreted from three mouse hybridomas, designated KT1, KT3, and KT4, produced antibodies that immunoprecipitated large T antigen[1][2]. |
|---|---|
| Related Catalog |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 1574ºC at 760 mmHg |
| Molecular Formula | C54H84N12O18 |
| Molecular Weight | 1189.31000 |
| Flash Point | 905.7ºC |
| Exact Mass | 1188.60000 |
| PSA | 442.66000 |
| Index of Refraction | 1.605 |
| InChIKey | DECUQDWFTZZXMZ-UHFFFAOYSA-N |
| SMILES | CC(O)C(NC(=O)C(CCC(=O)O)NC(=O)C1CCCN1C(=O)C(CCC(=O)O)NC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(NC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(N)CCCCN)C(C)O)C(=O)O |
| WGK Germany | 3 |
|---|
| lys-pro-pro-thr-pro-pro-pro-glu-pro-glu-thr |
| lys-pro-pro-thr-pro-pro-pro-glu-pro-glu |
| kpptpppepet |
| K-P-P-T-P-P-P-E-P-E-T |