(Dihydroxy-3,4 phenyl)-2 hydroxy-2 indanedione-1,3 [French]
Modify Date: 2025-09-20 15:55:08
![(Dihydroxy-3,4 phenyl)-2 hydroxy-2 indanedione-1,3 [French] Structure](https://image.chemsrc.com/caspic/062/75840-14-1.png)
(Dihydroxy-3,4 phenyl)-2 hydroxy-2 indanedione-1,3 [French] structure
|
Common Name | (Dihydroxy-3,4 phenyl)-2 hydroxy-2 indanedione-1,3 [French] | ||
|---|---|---|---|---|
| CAS Number | 75840-14-1 | Molecular Weight | 270.23700 | |
| Density | 1.608g/cm3 | Boiling Point | 592ºC at 760 mmHg | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.9ºC | |
| Name | 2-(3,4-dihydroxyphenyl)-2-hydroxyindene-1,3-dione |
|---|
| Density | 1.608g/cm3 |
|---|---|
| Boiling Point | 592ºC at 760 mmHg |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.23700 |
| Flash Point | 325.9ºC |
| Exact Mass | 270.05300 |
| PSA | 94.83000 |
| LogP | 1.36460 |
| Index of Refraction | 1.749 |
| InChIKey | BLJRKVJPVVZPMF-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)C1(O)c1ccc(O)c(O)c1 |
| HS Code | 2914501900 |
|---|
|
~6%
(Dihydroxy-3,4 ... CAS#:75840-14-1 |
| Literature: Poupelin; Saint-Ruf; Perche; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 253 - 262 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |