(Hydroxy-2-methoxy-3-phenyl)-2-hydroxy-2-indandione-1,3 structure
|
Common Name | (Hydroxy-2-methoxy-3-phenyl)-2-hydroxy-2-indandione-1,3 | ||
|---|---|---|---|---|
| CAS Number | 75840-15-2 | Molecular Weight | 284.26300 | |
| Density | 1.468g/cm3 | Boiling Point | 534.6ºC at 760 mmHg | |
| Molecular Formula | C16H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
| Name | 2-hydroxy-2-(2-hydroxy-3-methoxyphenyl)indene-1,3-dione |
|---|
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 534.6ºC at 760 mmHg |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.26300 |
| Flash Point | 204.8ºC |
| Exact Mass | 284.06800 |
| PSA | 83.83000 |
| LogP | 1.66760 |
| Index of Refraction | 1.68 |
| InChIKey | PFUWUQLIZHSOJM-UHFFFAOYSA-N |
| SMILES | COc1cccc(C2(O)C(=O)c3ccccc3C2=O)c1O |
| HS Code | 2914509090 |
|---|
|
~52%
(Hydroxy-2-meth... CAS#:75840-15-2 |
| Literature: Poupelin; Saint-Ruf; Perche; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 253 - 262 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |