methyl 1-(3-methoxy-3-oxopropyl)-2-oxocyclohexane-1-carboxylate structure
|
Common Name | methyl 1-(3-methoxy-3-oxopropyl)-2-oxocyclohexane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 75844-17-6 | Molecular Weight | 242.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-(3-methoxy-3-oxopropyl)-2-oxocyclohexane-1-carboxylate |
|---|
| Molecular Formula | C12H18O5 |
|---|---|
| Molecular Weight | 242.26800 |
| Exact Mass | 242.11500 |
| PSA | 69.67000 |
| LogP | 1.24210 |
| InChIKey | OFRYMLNXTYIBLN-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1(C(=O)OC)CCCCC1=O |
|
~89%
methyl 1-(3-met... CAS#:75844-17-6 |
| Literature: Ranu, Brindaban C.; Bhar, Sanjay Tetrahedron, 1992 , vol. 48, # 7 p. 1327 - 1332 |
|
~%
methyl 1-(3-met... CAS#:75844-17-6 |
| Literature: Soffer; Stewart Journal of the American Chemical Society, 1952 , vol. 74, p. 5801 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |