1,1,1-trichloro-3-nitro-pentan-2-ol structure
|
Common Name | 1,1,1-trichloro-3-nitro-pentan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 759-39-7 | Molecular Weight | 236.48100 | |
| Density | 1.512g/cm3 | Boiling Point | 269.8ºC at 760 mmHg | |
| Molecular Formula | C5H8Cl3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117ºC | |
| Name | 1,1,1-trichloro-3-nitropentan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.512g/cm3 |
|---|---|
| Boiling Point | 269.8ºC at 760 mmHg |
| Molecular Formula | C5H8Cl3NO3 |
| Molecular Weight | 236.48100 |
| Flash Point | 117ºC |
| Exact Mass | 234.95700 |
| PSA | 66.05000 |
| LogP | 2.29600 |
| Index of Refraction | 1.515 |
| InChIKey | JUWWADPDXYJWTL-UHFFFAOYSA-N |
| SMILES | CCC(C(O)C(Cl)(Cl)Cl)[N+](=O)[O-] |
|
~%
1,1,1-trichloro... CAS#:759-39-7 |
| Literature: Malkiel; Mason Journal of the American Chemical Society, 1942 , vol. 64, p. 2515 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1,1,1-trichloro-3-nitro-pentan-2-ol |
| 1,1,1-Trichloro-3-nitro-2-pentanol |
| Trichlormethyl-(1-nitro-propyl)-carbinol |
| 1,1,1-Trichlor-3-nitro-pentan-2-ol |
| 1-Trichlor-3-nitro-2-pentanol |
| 1,1,1-Trichlor-3-nitro-pentanol-(2) |