6H-Indolo[2,3-b]quinoxaline, 7,9-dichloro- structure
|
Common Name | 6H-Indolo[2,3-b]quinoxaline, 7,9-dichloro- | ||
|---|---|---|---|---|
| CAS Number | 75907-81-2 | Molecular Weight | 288.13100 | |
| Density | 1.596g/cm3 | Boiling Point | 538.2ºC at 760 mmHg | |
| Molecular Formula | C14H7Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.6ºC | |
| Name | 7,9-dichloro-6H-indolo[3,2-b]quinoxaline |
|---|
| Density | 1.596g/cm3 |
|---|---|
| Boiling Point | 538.2ºC at 760 mmHg |
| Molecular Formula | C14H7Cl2N3 |
| Molecular Weight | 288.13100 |
| Flash Point | 309.6ºC |
| Exact Mass | 287.00200 |
| PSA | 41.57000 |
| LogP | 4.57110 |
| Index of Refraction | 1.843 |
| InChIKey | YDUWMXJTLKWJGL-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c2[nH]c3nc4ccccc4nc3c2c1 |
|
~82%
6H-Indolo[2,3-b... CAS#:75907-81-2 |
| Literature: Sarkis; Al-Badri Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 4 p. 813 - 815 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |