Methyl 1-(4-nitrophenyl)piperidine-4-carboxylate structure
|
Common Name | Methyl 1-(4-nitrophenyl)piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7595-60-0 | Molecular Weight | 264.27700 | |
| Density | 1.251g/cm3 | Boiling Point | 415.9ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | methyl 1-(4-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 415.9ºC at 760 mmHg |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.27700 |
| Flash Point | 205.3ºC |
| Exact Mass | 264.11100 |
| PSA | 75.36000 |
| LogP | 2.57240 |
| Index of Refraction | 1.562 |
| InChIKey | HKORQLPDNXLTAL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~84%
Methyl 1-(4-nit... CAS#:7595-60-0 |
| Literature: COUNCIL OF SCIENTIFIC and INDUSTRIAL RESEARCH; KAMAL, Ahmed; VISWANATH, Arutla; MURTY, Jayanti Naga Srirama Chandra; SULTHANA, Farheen; RAMAKRISHNA, Gadupudi; KHAN, Inshad Ali; KALIA, Nitin Pal Patent: WO2013/93940 A1, 2013 ; Location in patent: Page/Page column 15; 16 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-nitrophenyl)-4-piperidinecarboxylate |
| 1-(4-nitrophenyl)-piperidine-4-carboxylic acid methyl ester |
| methyl 1-(4-nitrophenyl)-4-piperidinecarboxylate |