4-Methyl-1-(4-nitrophenyl)piperidine structure
|
Common Name | 4-Methyl-1-(4-nitrophenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 78019-77-9 | Molecular Weight | 220.268 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 366.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4±23.2 °C | |
| Name | 4-methyl-1-(4-nitrophenyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.5±25.0 °C at 760 mmHg |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.268 |
| Flash Point | 175.4±23.2 °C |
| Exact Mass | 220.121185 |
| PSA | 49.06000 |
| LogP | 3.92 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | QUDBEBFQYDWSTJ-UHFFFAOYSA-N |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Piperidine, 4-methyl-1-(4-nitrophenyl)- |
| 4-Methyl-1-(4-nitro-phenyl)-piperidine |
| 4-Methyl-1-(4-nitrophenyl)piperidine |