Benzoic acid,4-methyl-2-nitro-3-(phenylmethoxy)-, phenylmethyl ester structure
|
Common Name | Benzoic acid,4-methyl-2-nitro-3-(phenylmethoxy)-, phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7597-50-4 | Molecular Weight | 377.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 4-methyl-2-nitro-3-phenylmethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H19NO5 |
|---|---|
| Molecular Weight | 377.39000 |
| Exact Mass | 377.12600 |
| PSA | 81.35000 |
| LogP | 5.36240 |
| InChIKey | YKBJUTVEODSQGP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)OCc2ccccc2)c([N+](=O)[O-])c1OCc1ccccc1 |
|
~83%
Benzoic acid,4-... CAS#:7597-50-4 |
| Literature: Pena; Stille Journal of the American Chemical Society, 1989 , vol. 111, # 14 p. 5417 - 5424 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzyl-3-benzyloxy-2-nitro-p-toluat |
| BENZYL 4-METHYL-2-NITRO-3-PHENYLMETHOXY-BENZOATE |
| 3-benzyloxy-4-methyl-2-nitrobenzoic acid benzyl ester |