[5,5'-Bipyrimidine]-2,2',4,4',6,6'(1H,1'H,3H,3'H,5H,5'H)-hexone,5,5'-dihydroxy
Modify Date: 2025-09-20 12:34:35
![[5,5'-Bipyrimidine]-2,2',4,4',6,6'(1H,1'H,3H,3'H,5H,5'H)-hexone,5,5'-dihydroxy Structure](https://image.chemsrc.com/caspic/471/76-24-4.png)
[5,5'-Bipyrimidine]-2,2',4,4',6,6'(1H,1'H,3H,3'H,5H,5'H)-hexone,5,5'-dihydroxy structure
|
Common Name | [5,5'-Bipyrimidine]-2,2',4,4',6,6'(1H,1'H,3H,3'H,5H,5'H)-hexone,5,5'-dihydroxy | ||
|---|---|---|---|---|
| CAS Number | 76-24-4 | Molecular Weight | 286.15500 | |
| Density | 2.036g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H6N4O8 | Melting Point | 250 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | alloxantin |
|---|---|
| Synonym | More Synonyms |
| Density | 2.036g/cm3 |
|---|---|
| Melting Point | 250 °C (dec.)(lit.) |
| Molecular Formula | C8H6N4O8 |
| Molecular Weight | 286.15500 |
| Exact Mass | 286.01900 |
| PSA | 191.00000 |
| Index of Refraction | 1.663 |
| InChIKey | IWDDXZKCDHOOSF-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(O)(C2(O)C(=O)NC(=O)NC2=O)C(=O)N1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/39 |
| WGK Germany | 2 |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
Total 1, Current Page 1 of 1
1
| 5,5'-dihydroxy-5,5'-bipyrimidinehexaone |
| Uroxine |
| alloxathin |
| alloxanthin |
| ALLOXANTIN HYDRATE |
| Uroxin |
| 5,5Dihydroxy-5,5dibarbitur |
| EINECS 200-947-1 |
| MFCD00042797 |