3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl
![3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl Structure](https://image.chemsrc.com/caspic/340/76-32-4.png)
3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl structure
|
Common Name | 3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 76-32-4 | Molecular Weight | 318.45000 | |
| Density | 1.137 g/cm3 | Boiling Point | 269-271°C | |
| Molecular Formula | C20H30O3 | Melting Point | 222-225 °C | |
| MSDS | Chinese USA | Flash Point | 269-271°C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dl-camphoric anhydride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.137 g/cm3 |
|---|---|
| Boiling Point | 269-271°C |
| Melting Point | 222-225 °C |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.45000 |
| Flash Point | 269-271°C |
| Exact Mass | 318.21900 |
| PSA | 43.37000 |
| LogP | 4.48900 |
| Index of Refraction | 1.531 |
| InChIKey | VFZDNKRDYPTSTP-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(=O)OC1=O)C2(C)C |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:306935-15-9
CAS#:124-83-4
CAS#:7722-84-1
CAS#:5587-63-3
CAS#:33059-69-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| camphoric acid anhydride |
| EINECS 200-952-9 |
| 1,2,2-Trimethyl-cyclopentan-1,3-dicarbonsaeure-anhydrid |
| 1,3-Cyclopentanedicarboxylic anhydride,1,2,2-trimethyl |
| Camphoric anhydride unspecified stereo isomer |
| DL-CAMPHOR ANHYDRIDE |
| 1,2,2-trimethyl-cyclopentane-1,3-dicarboxylic acid anhydride |
| MFCD00067307 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of dl-camphoric anhydride? |
| A: LogP of dl-camphoric anhydride is 4.48900. |
| Q: What is the InChIKey of dl-camphoric anhydride? |
| A: InChIKey of dl-camphoric anhydride is VFZDNKRDYPTSTP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of dl-camphoric anhydride? |
| A: Molecular formula of dl-camphoric anhydride is C20H30O3. |
| Q: What is the English name of dl-camphoric anhydride? |
| A: The English name of dl-camphoric anhydride is dl-camphoric anhydride. |
| Q: What is the SMILES notation of dl-camphoric anhydride? |
| A: SMILES notation of dl-camphoric anhydride is CC12CCC(C(=O)OC1=O)C2(C)C. |
| Q: What is the polar surface area (PSA) of dl-camphoric anhydride? |
| A: Polar surface area (PSA) of dl-camphoric anhydride is 43.37000. |
| Q: What are the downstream products of dl-camphoric anhydride? |
| A: Related downstream products(CAS) of dl-camphoric anhydride: 306935-15-9;124-83-4;7722-84-1;5587-63-3;33059-69-7. |
| Q: What is the safety information for dl-camphoric anhydride? |
| A: Safety information for dl-camphoric anhydride: S26. |
| Q: What English synonyms does dl-camphoric anhydride have? |
| A: English synonyms of dl-camphoric anhydride: camphoric acid anhydride, EINECS 200-952-9, 1,2,2-Trimethyl-cyclopentan-1,3-dicarbonsaeure-anhydrid, 1,3-Cyclopentanedicarboxylic anhydride,1,2,2-trimethyl, Camphoric anhydride unspecified stereo isomer, DL-CAMPHOR ANHYDRIDE, 1,2,2-trimethyl-cyclopentane-1,3-dicarboxylic acid anhydride, MFCD00067307. |
| Q: What is the boiling point of dl-camphoric anhydride? |
| A: Boiling point of dl-camphoric anhydride is 269-271°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |