3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl structure
|
Common Name | 3-Oxabicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 76-32-4 | Molecular Weight | 318.45000 | |
| Density | 1.137 g/cm3 | Boiling Point | 269-271°C | |
| Molecular Formula | C20H30O3 | Melting Point | 222-225 °C | |
| MSDS | Chinese USA | Flash Point | 269-271°C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | dl-camphoric anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137 g/cm3 |
|---|---|
| Boiling Point | 269-271°C |
| Melting Point | 222-225 °C |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.45000 |
| Flash Point | 269-271°C |
| Exact Mass | 318.21900 |
| PSA | 43.37000 |
| LogP | 4.48900 |
| Index of Refraction | 1.531 |
| InChIKey | VFZDNKRDYPTSTP-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(=O)OC1=O)C2(C)C |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| camphoric acid anhydride |
| EINECS 200-952-9 |
| 1,2,2-Trimethyl-cyclopentan-1,3-dicarbonsaeure-anhydrid |
| 1,3-Cyclopentanedicarboxylic anhydride,1,2,2-trimethyl |
| Camphoric anhydride unspecified stereo isomer |
| DL-CAMPHOR ANHYDRIDE |
| 1,2,2-trimethyl-cyclopentane-1,3-dicarboxylic acid anhydride |
| MFCD00067307 |