Diethyl 2-ethyl-2-(pentan-2-yl)malonate
Diethyl 2-ethyl-2-(pentan-2-yl)malonate structure
|
Common Name | Diethyl 2-ethyl-2-(pentan-2-yl)malonate | ||
|---|---|---|---|---|
| CAS Number | 76-72-2 | Molecular Weight | 258.35400 | |
| Density | 0.967 g/cm3 | Boiling Point | 267.6ºC at 760 mmHg | |
| Molecular Formula | C14H26O4 | Melting Point | 155-157 | |
| MSDS | N/A | Flash Point | 114.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl ethyl(1-methylbutyl)malonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.967 g/cm3 |
|---|---|
| Boiling Point | 267.6ºC at 760 mmHg |
| Melting Point | 155-157 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.35400 |
| Flash Point | 114.2ºC |
| Exact Mass | 258.18300 |
| PSA | 52.60000 |
| LogP | 2.94520 |
| Index of Refraction | 1.44 |
| InChIKey | ZQGOJSLHZOKIBV-UHFFFAOYSA-N |
| SMILES | CCCC(C)C(CC)(C(=O)OCC)C(=O)OCC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 3 | |
CAS#:74-96-4
CAS#:625-30-9
CAS#:117-47-5
CAS#:26184-62-3
CAS#:637-97-8
CAS#:133-13-1
CAS#:76-74-4
CAS#:74581-94-5
CAS#:66794-04-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00129160 |
| diethyl 2-ethyl-2-pentan-2-yl-propanedioate |
| diethyl ester of ethyl-1-methylbutylmalonic acid |
| EINECS 200-981-7 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of Diethyl ethyl(1-methylbutyl)malonate? |
| A: Boiling point of Diethyl ethyl(1-methylbutyl)malonate is 267.6ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of Diethyl ethyl(1-methylbutyl)malonate? |
| A: Polar surface area (PSA) of Diethyl ethyl(1-methylbutyl)malonate is 52.60000. |
| Q: What English synonyms does Diethyl ethyl(1-methylbutyl)malonate have? |
| A: English synonyms of Diethyl ethyl(1-methylbutyl)malonate: MFCD00129160, diethyl 2-ethyl-2-pentan-2-yl-propanedioate, diethyl ester of ethyl-1-methylbutylmalonic acid, EINECS 200-981-7. |
| Q: What are the upstream materials of Diethyl ethyl(1-methylbutyl)malonate? |
| A: Related upstream materials(CAS) of Diethyl ethyl(1-methylbutyl)malonate: 74-96-4;625-30-9;117-47-5;26184-62-3;637-97-8;133-13-1. |
| Q: What is the molecular formula of Diethyl ethyl(1-methylbutyl)malonate? |
| A: Molecular formula of Diethyl ethyl(1-methylbutyl)malonate is C14H26O4. |
| Q: What is the CAS number of Diethyl ethyl(1-methylbutyl)malonate? |
| A: CAS number of Diethyl ethyl(1-methylbutyl)malonate is 76-72-2. |
| Q: What is the InChIKey of Diethyl ethyl(1-methylbutyl)malonate? |
| A: InChIKey of Diethyl ethyl(1-methylbutyl)malonate is ZQGOJSLHZOKIBV-UHFFFAOYSA-N. |
| Q: What is the melting point of Diethyl ethyl(1-methylbutyl)malonate? |
| A: Melting point of Diethyl ethyl(1-methylbutyl)malonate is 155-157. |
| Q: What is the LogP of Diethyl ethyl(1-methylbutyl)malonate? |
| A: LogP of Diethyl ethyl(1-methylbutyl)malonate is 2.94520. |
| Q: What is the molecular weight of Diethyl ethyl(1-methylbutyl)malonate? |
| A: Molecular weight of Diethyl ethyl(1-methylbutyl)malonate is 258.35400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |