Diethyl 2-ethyl-2-(pentan-2-yl)malonate structure
|
Common Name | Diethyl 2-ethyl-2-(pentan-2-yl)malonate | ||
|---|---|---|---|---|
| CAS Number | 76-72-2 | Molecular Weight | 258.35400 | |
| Density | 0.967 g/cm3 | Boiling Point | 267.6ºC at 760 mmHg | |
| Molecular Formula | C14H26O4 | Melting Point | 155-157 | |
| MSDS | N/A | Flash Point | 114.2ºC | |
| Name | Diethyl ethyl(1-methylbutyl)malonate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.967 g/cm3 |
|---|---|
| Boiling Point | 267.6ºC at 760 mmHg |
| Melting Point | 155-157 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.35400 |
| Flash Point | 114.2ºC |
| Exact Mass | 258.18300 |
| PSA | 52.60000 |
| LogP | 2.94520 |
| Index of Refraction | 1.44 |
| InChIKey | ZQGOJSLHZOKIBV-UHFFFAOYSA-N |
| SMILES | CCCC(C)C(CC)(C(=O)OCC)C(=O)OCC |
| Hazard Codes | Xi |
|---|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| MFCD00129160 |
| diethyl 2-ethyl-2-pentan-2-yl-propanedioate |
| diethyl ester of ethyl-1-methylbutylmalonic acid |
| EINECS 200-981-7 |