Methyl 12,13-dimethoxyibogamine-18-carboxylate
Methyl 12,13-dimethoxyibogamine-18-carboxylate structure
|
Common Name | Methyl 12,13-dimethoxyibogamine-18-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 76-98-2 | Molecular Weight | 398.495 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 536.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H30N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.5±30.1 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Conopharyngine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 536.8±50.0 °C at 760 mmHg |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.495 |
| Flash Point | 278.5±30.1 °C |
| Exact Mass | 398.220551 |
| PSA | 63.79000 |
| LogP | 3.80 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | DUFLXLVGASPEMV-UHFFFAOYSA-N |
| SMILES | CCC1CC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C(C(=O)OC)(C2)C13 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ibogamine-18-carboxylic acid, 12,13-dimethoxy-, methyl ester |
| Methyl 12,13-dimethoxyibogamine-18-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Conopharyngine? |
| A: InChIKey of Conopharyngine is DUFLXLVGASPEMV-UHFFFAOYSA-N. |
| Q: What is the CAS number of Conopharyngine? |
| A: CAS number of Conopharyngine is 76-98-2. |
| Q: What is the boiling point of Conopharyngine? |
| A: Boiling point of Conopharyngine is 536.8±50.0 °C at 760 mmHg. |
| Q: What is the English name of Conopharyngine? |
| A: The English name of Conopharyngine is Conopharyngine. |
| Q: What is the LogP of Conopharyngine? |
| A: LogP of Conopharyngine is 3.80. |
| Q: What is the molecular weight of Conopharyngine? |
| A: Molecular weight of Conopharyngine is 398.495. |
| Q: What English synonyms does Conopharyngine have? |
| A: English synonyms of Conopharyngine: Ibogamine-18-carboxylic acid, 12,13-dimethoxy-, methyl ester, Methyl 12,13-dimethoxyibogamine-18-carboxylate. |
| Q: What is the molecular formula of Conopharyngine? |
| A: Molecular formula of Conopharyngine is C23H30N2O4. |
| Q: What is the polar surface area (PSA) of Conopharyngine? |
| A: Polar surface area (PSA) of Conopharyngine is 63.79000. |
| Q: What is the SMILES notation of Conopharyngine? |
| A: SMILES notation of Conopharyngine is CCC1CC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C(C(=O)OC)(C2)C13. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |