imidazo(1,2-a)quinoxaline-2-carboxylicacid structure
|
Common Name | imidazo(1,2-a)quinoxaline-2-carboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 76002-75-0 | Molecular Weight | 213.19200 | |
| Density | 1.53g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | imidazo[1,2-a]quinoxaline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.19200 |
| Exact Mass | 213.05400 |
| PSA | 67.49000 |
| LogP | 1.58070 |
| Index of Refraction | 1.763 |
| InChIKey | JVKYTWZLUFMIKS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cn2c(cnc3ccccc32)n1 |
| HS Code | 2933990090 |
|---|
|
~%
imidazo(1,2-a)q... CAS#:76002-75-0 |
| Literature: Ager; Barnes; Danswan; Hairsine; Kay; Kennewell; Matharu; Miller; Robson; Rowlands; Tully; Westwood Journal of Medicinal Chemistry, 1988 , vol. 31, # 6 p. 1098 - 1115 |
|
~%
imidazo(1,2-a)q... CAS#:76002-75-0 |
| Literature: Ager; Barnes; Danswan; Hairsine; Kay; Kennewell; Matharu; Miller; Robson; Rowlands; Tully; Westwood Journal of Medicinal Chemistry, 1988 , vol. 31, # 6 p. 1098 - 1115 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of the IgE-mediated passive cutaneous anaphylaxis (PCA) reaction in rat af...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL786160
|
|
Name: Inhibition of the IgE-mediated passive cutaneous anaphylaxis (PCA) reaction in rat af...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL781475
|
| Dazoquinastum |
| Dazoquinast |
| Dazoquinastum [Latin] |
| UNII-A16F9MIN3Z |
| imidazo-[1,2-a]-quinoxaline-2-carboxylic acid |