5-Amino-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentanoic acid structure
|
Common Name | 5-Amino-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7607-72-9 | Molecular Weight | 276.24500 | |
| Density | 1.508g/cm3 | Boiling Point | 599.3ºC at 760mmHg | |
| Molecular Formula | C13H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.3ºC | |
| Name | 5-Amino-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.508g/cm3 |
|---|---|
| Boiling Point | 599.3ºC at 760mmHg |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.24500 |
| Flash Point | 316.3ºC |
| Exact Mass | 276.07500 |
| PSA | 118.76000 |
| LogP | 1.08890 |
| InChIKey | JMKLVQRQCLMCIN-UHFFFAOYSA-N |
| SMILES | NC(=O)CCC(C(=O)O)N1C(=O)c2ccccc2C1=O |
|
~%
5-Amino-2-(1,3-... CAS#:7607-72-9 |
| Literature: King; Kidd Journal of the Chemical Society, 1949 , p. 3315,3318 |
|
~%
5-Amino-2-(1,3-... CAS#:7607-72-9 |
| Literature: Antibioticos S.p.A. Patent: EP1602654 A1, 2005 ; Location in patent: Page/Page column 4/5-6 ; |
|
~%
5-Amino-2-(1,3-... CAS#:7607-72-9 |
| Literature: Antibioticos S.p.A. Patent: EP1602654 A1, 2005 ; Location in patent: Page/Page column 5/7 ; |
|
~%
5-Amino-2-(1,3-... CAS#:7607-72-9 |
| Literature: Nakamura, Takanori; Noguchi, Tomomi; Miyachi, Hiroyuki; Hashimoto, Yuichi Chemical and Pharmaceutical Bulletin, 2007 , vol. 55, # 4 p. 651 - 654 |
| N-phthalyl-glutamine |
| Phenyl-phthalimido-essigsaeure |
| N-phthaloyl phenylglycine |
| (+-)-2-Phthalimido-buttersaeure |
| N-phtaloyl-glutamine |
| N-Phthalyl-D,L-glutamine |
| 2-(1,3-dioxoisoindolin-2-yl)butanoic acid |
| N2,N2-Phthaloyl-DL-glutamin |
| N-phthalyl-(RS)-phenylglycine |
| (+-)-2-phthalimido-butyric acid |
| N-phthalyl-(RS)-amino butyric acid |
| 2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butanoic acid |
| 2-(1,3-dioxobenzo[c]azolin-2-yl)butanoic acid |
| N-phthalyl phenylglycine acid |
| phenyl-phthalimido-acetic acid |
| 2-phthalimido-2-phenylacetic acid |
| N2,N2-phthaloyl-DL-glutamine |
| 2-phthalimidoglutaramic acid |