N-(4-nitrophenyl)-2H-triazol-4-amine structure
|
Common Name | N-(4-nitrophenyl)-2H-triazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 76109-76-7 | Molecular Weight | 205.17300 | |
| Density | 1.553g/cm3 | Boiling Point | 485.6ºC at 760 mmHg | |
| Molecular Formula | C8H7N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.5ºC | |
| Name | N-(4-nitrophenyl)-2H-triazol-4-amine |
|---|
| Density | 1.553g/cm3 |
|---|---|
| Boiling Point | 485.6ºC at 760 mmHg |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.17300 |
| Flash Point | 247.5ºC |
| Exact Mass | 205.06000 |
| PSA | 99.42000 |
| LogP | 2.05270 |
| Index of Refraction | 1.731 |
| InChIKey | XOCXVGWAGIHELG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Nc2cn[nH]n2)cc1 |
|
~10%
N-(4-nitropheny... CAS#:76109-76-7 |
| Literature: Baines, Kim M.; Rourke, Timothy W.; Vaughan, Keith; Hooper, Donald L. Journal of Organic Chemistry, 1981 , vol. 46, # 5 p. 856 - 859 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |