1-(3-Methoxy-4-nitrophenyl)-4-methylpiperazine structure
|
Common Name | 1-(3-Methoxy-4-nitrophenyl)-4-methylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 761440-26-0 | Molecular Weight | 251.282 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 409.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H18N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.6±28.7 °C | |
| Name | 1-(3-Methoxy-4-nitrophenyl)-4-methylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.7±45.0 °C at 760 mmHg |
| Molecular Formula | C12H18N3O3 |
| Molecular Weight | 251.282 |
| Flash Point | 201.6±28.7 °C |
| Exact Mass | 251.126984 |
| PSA | 65.37000 |
| LogP | 2.02 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | MKTFAOFIZMORTQ-UHFFFAOYSA-N |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(3-Methoxy-4-nitrophenyl)-4-methylpiperazine |
| 2-methoxy-4-(4-methylpiperazin-1-yl)phenylazinic acid |
| Piperazine, 1-(3-methoxy-4-nitrophenyl)-4-methyl- |