1-(3-Methoxy-4-nitrophenyl)piperidin-4-ol structure
|
Common Name | 1-(3-Methoxy-4-nitrophenyl)piperidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 761440-22-6 | Molecular Weight | 252.26600 | |
| Density | 1.296g/cm3 | Boiling Point | 458.8ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.2ºC | |
| Name | 1-(3-Methoxy-4-nitrophenyl)piperidin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 458.8ºC at 760 mmHg |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.26600 |
| Flash Point | 231.2ºC |
| Exact Mass | 252.11100 |
| PSA | 78.52000 |
| LogP | 2.15270 |
| Index of Refraction | 1.592 |
| InChIKey | SNYOQELAUCYAKA-UHFFFAOYSA-N |
| SMILES | COc1cc(N2CCC(O)CC2)ccc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(3-methoxy-4-nitrophenyl)piperidin-4-ol |