1-Benzyl-1H-pyrazole-4-boronic acid pinacol ester structure
|
Common Name | 1-Benzyl-1H-pyrazole-4-boronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 761446-45-1 | Molecular Weight | 284.161 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 427.9±28.0 °C at 760 mmHg | |
| Molecular Formula | C16H21BN2O2 | Melting Point | 86-91ºC | |
| MSDS | N/A | Flash Point | 212.6±24.0 °C | |
| Name | 1-Benzyl-4-pyrazoleboronic Acid Pinacol Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.9±28.0 °C at 760 mmHg |
| Melting Point | 86-91ºC |
| Molecular Formula | C16H21BN2O2 |
| Molecular Weight | 284.161 |
| Flash Point | 212.6±24.0 °C |
| Exact Mass | 284.169617 |
| PSA | 36.28000 |
| LogP | 2.23060 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | ZVPORPUUZXIPEF-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cnn(Cc3ccccc3)c2)OC1(C)C |
| Water Solubility | Insoluble |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~60%
1-Benzyl-1H-pyr... CAS#:761446-45-1 |
| Literature: Kalypsys, Inc Patent: US8080566 B1, 2011 ; Location in patent: Page/Page column 57 ; |
|
~%
1-Benzyl-1H-pyr... CAS#:761446-45-1 |
| Literature: F. HOFFMANN-LA ROCHE AG; GENENTECH, INC.; BURDICK, Daniel Jon; CHEN, Huifen; WANG, Shumei; WANG, Weiru Patent: WO2014/60395 A1, 2014 ; Location in patent: Page/Page column 35 ; |
|
~%
1-Benzyl-1H-pyr... CAS#:761446-45-1 |
| Literature: Organic and Biomolecular Chemistry, , vol. 9, # 9 p. 3139 - 3141 |
|
~%
1-Benzyl-1H-pyr... CAS#:761446-45-1 |
| Literature: US8080566 B1, ; |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| 1H-Pyrazole, 1-(phenylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |
| MFCD03789252 |
| 1-Benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| 1-Benzyl-1H-pyrazole-4-boronic acid pinacol ester |