N-[2-(1H-indol-4-yl)ethyl]-N-propylpropan-1-amine structure
|
Common Name | N-[2-(1H-indol-4-yl)ethyl]-N-propylpropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 76149-15-0 | Molecular Weight | 244.37500 | |
| Density | 1.014g/cm3 | Boiling Point | 387.4ºC at 760 mmHg | |
| Molecular Formula | C16H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.1ºC | |
| Name | N-[2-(1H-indol-4-yl)ethyl]-N-propylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.014g/cm3 |
|---|---|
| Boiling Point | 387.4ºC at 760 mmHg |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.37500 |
| Flash Point | 188.1ºC |
| Exact Mass | 244.19400 |
| PSA | 19.03000 |
| LogP | 3.83240 |
| Index of Refraction | 1.574 |
| InChIKey | AFRBPRLOPBAGCM-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CCc1cccc2[nH]ccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Dpaei |
| DPAI |
| 4-<2-(N,N-di-n-propylamino)ethyl>indole |
| 4-(2-Di-N-propylaminoethyl)indole |
| 1H-Indole-4-ethanamine,N,N-dipropyl |
| 4-[2-(dipropylamino)ethyl]indole |