4,6(1H,5H)-Pyrimidinedione,1-(2-chlorophenyl)dihydro-5-[2-(2-methylphenyl)diazenyl]-3-phenyl-2-thioxo- structure
|
Common Name | 4,6(1H,5H)-Pyrimidinedione,1-(2-chlorophenyl)dihydro-5-[2-(2-methylphenyl)diazenyl]-3-phenyl-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 76153-28-1 | Molecular Weight | 448.92500 | |
| Density | 1.35g/cm3 | Boiling Point | 564.4ºC at 760 mmHg | |
| Molecular Formula | C23H17ClN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.1ºC | |
| Name | (5E)-1-(2-chlorophenyl)-5-[(2-methylphenyl)hydrazinylidene]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 564.4ºC at 760 mmHg |
| Molecular Formula | C23H17ClN4O2S |
| Molecular Weight | 448.92500 |
| Flash Point | 295.1ºC |
| Exact Mass | 448.07600 |
| PSA | 103.97000 |
| LogP | 6.44050 |
| Index of Refraction | 1.684 |
| InChIKey | YJBCHSWIICEOHT-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1N=Nc1c(O)n(-c2ccccc2Cl)c(=S)n(-c2ccccc2)c1=O |
|
~%
4,6(1H,5H)-Pyri... CAS#:76153-28-1 |
| Literature: Singh, S.; Behl, C. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 7 p. 625 - 626 |
|
~%
4,6(1H,5H)-Pyri... CAS#:76153-28-1 |
| Literature: Singh, S.; Behl, C. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 7 p. 625 - 626 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |