Thiourea,N-(2-chlorophenyl)-N'-phenyl- structure
|
Common Name | Thiourea,N-(2-chlorophenyl)-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1932-36-1 | Molecular Weight | 262.75800 | |
| Density | 1.385g/cm3 | Boiling Point | 371.4ºC at 760 mmHg | |
| Molecular Formula | C13H11ClN2S | Melting Point | 156ºC | |
| MSDS | N/A | Flash Point | 178.4ºC | |
| Name | 1-(2-Chlorophenyl)-3-phenyl-2-thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.385g/cm3 |
|---|---|
| Boiling Point | 371.4ºC at 760 mmHg |
| Melting Point | 156ºC |
| Molecular Formula | C13H11ClN2S |
| Molecular Weight | 262.75800 |
| Flash Point | 178.4ºC |
| Exact Mass | 262.03300 |
| PSA | 56.15000 |
| LogP | 4.29490 |
| Vapour Pressure | 1.04E-05mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | GJXBIVMCTDXUKR-UHFFFAOYSA-N |
| SMILES | S=C(Nc1ccccc1)Nc1ccccc1Cl |
| HS Code | 2930909090 |
|---|
|
~98%
Thiourea,N-(2-c... CAS#:1932-36-1 |
| Literature: Baltabaev; Makhsumov; Zakirov; Babaev; Shukurullaev Pharmaceutical Chemistry Journal, 2002 , vol. 36, # 2 p. 77 - 79 |
|
~82%
Thiourea,N-(2-c... CAS#:1932-36-1 |
| Literature: Muthusamy, Sengoden; Paramasivam, Rangasamy; Ramakrishnan, Vayalakkavoor T. Journal of Heterocyclic Chemistry, 1991 , vol. 28, # 3 p. 759 - 763 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(2-CHLOROPHENYL)-3-PHENYL-2-THIOUREA |
| 1-(2-chlorophenyl)-3-phenylthiourea |