DXPD
Modify Date: 2025-08-25 08:51:34
DXPD structure
|
Common Name | DXPD | ||
|---|---|---|---|---|
| CAS Number | 76154-76-2 | Molecular Weight | 316.43900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-N,4-N-bis(2,4-dimethylphenyl)benzene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H24N2 |
|---|---|
| Molecular Weight | 316.43900 |
| Exact Mass | 316.19400 |
| PSA | 24.06000 |
| LogP | 6.55340 |
| InChIKey | RFFXHZVNHOVMKO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2ccc(Nc3ccc(C)cc3C)cc2)c(C)c1 |
| HS Code | 2921590090 |
|---|
|
~83%
DXPD CAS#:76154-76-2 |
| Literature: Kuhl, Sebastien; Fort, Yves; Schneider, Raphael Journal of Organometallic Chemistry, 2005 , vol. 690, # 24-25 p. 6169 - 6177 |
|
~%
DXPD CAS#:76154-76-2 |
| Literature: Buu-Hoi Journal of the Chemical Society, 1952 , p. 4346,4348,4349 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| DXPD |
| N,N'-dixylyl-para-phenylenediamine |
| N,N'-Bis-(2,4-dimethylphenyl)-p-phenylenediamine |