methyl 3-(4-chlorophenyl)-2-isocyanobut-2-enoate structure
|
Common Name | methyl 3-(4-chlorophenyl)-2-isocyanobut-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 76203-06-0 | Molecular Weight | 235.66600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-(4-chlorophenyl)-2-isocyanobut-2-enoate |
|---|
| Molecular Formula | C12H10ClNO2 |
|---|---|
| Molecular Weight | 235.66600 |
| Exact Mass | 235.04000 |
| PSA | 26.30000 |
| LogP | 2.39400 |
| InChIKey | JXNNXZPPASCIII-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C(C(=O)OC)=C(C)c1ccc(Cl)cc1 |
|
~95%
methyl 3-(4-chl... CAS#:76203-06-0 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
|
~%
methyl 3-(4-chl... CAS#:76203-06-0 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |