methyl 3-(4-chlorophenyl)-2-isocyanoprop-2-enoate structure
|
Common Name | methyl 3-(4-chlorophenyl)-2-isocyanoprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 68001-86-5 | Molecular Weight | 221.64000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-(4-chlorophenyl)-2-isocyanoprop-2-enoate |
|---|
| Molecular Formula | C11H8ClNO2 |
|---|---|
| Molecular Weight | 221.64000 |
| Exact Mass | 221.02400 |
| PSA | 26.30000 |
| LogP | 2.00390 |
| InChIKey | OMZCFBWNQWVOKP-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C(=Cc1ccc(Cl)cc1)C(=O)OC |
|
~%
methyl 3-(4-chl... CAS#:68001-86-5 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
|
~%
methyl 3-(4-chl... CAS#:68001-86-5 |
| Literature: Suzuki; Nunami; Matsumoto; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2374 - 2383 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |