1-methylsulfonyl-4-(trichloromethyl)benzene structure
|
Common Name | 1-methylsulfonyl-4-(trichloromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 76213-17-7 | Molecular Weight | 273.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Cl3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methylsulfonyl-4-(trichloromethyl)benzene |
|---|
| Molecular Formula | C8H7Cl3O2S |
|---|---|
| Molecular Weight | 273.56400 |
| Exact Mass | 271.92300 |
| PSA | 42.52000 |
| LogP | 3.99760 |
| InChIKey | MORNEPHYIBISFF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(Cl)(Cl)Cl)cc1 |
|
~96%
1-methylsulfony... CAS#:76213-17-7 |
| Literature: Marsh, F. D.; Farnham, W. B.; Sam, D. J.; Smart, B. E. Journal of the American Chemical Society, 1982 , vol. 104, # 17 p. 4680 - 4682 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |