N-(9,10-dihydroxy-1,2,3-trimethoxy-5,6,7,8,9,10,11,12-octahydrobenzo[a]heptalen-7-yl)acetamide structure
|
Common Name | N-(9,10-dihydroxy-1,2,3-trimethoxy-5,6,7,8,9,10,11,12-octahydrobenzo[a]heptalen-7-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 7622-04-0 | Molecular Weight | 391.45800 | |
| Density | 1.26g/cm3 | Boiling Point | 643.3ºC at 760 mmHg | |
| Molecular Formula | C21H29NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.8ºC | |
| Name | N-(9,10-dihydroxy-1,2,3-trimethoxy-5,6,7,8,9,10,11,12-octahydrobenzo[a]heptalen-7-yl)acetamide |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 643.3ºC at 760 mmHg |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.45800 |
| Flash Point | 342.8ºC |
| Exact Mass | 391.19900 |
| PSA | 97.25000 |
| LogP | 2.21350 |
| Index of Refraction | 1.586 |
| InChIKey | MMCKKLQISMJLPI-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c(OC)c1OC)C1=C(CC(O)C(O)CC1)C(NC(C)=O)CC2 |
|
~%
N-(9,10-dihydro... CAS#:7622-04-0 |
| Literature: Arnstein et al. Journal of the American Chemical Society, 1949 , vol. 71, p. 2448,2450, 2451 |
|
~%
N-(9,10-dihydro... CAS#:7622-04-0 |
| Literature: Arnstein et al. Journal of the American Chemical Society, 1949 , vol. 71, p. 2448,2450, 2451 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |