5'-O-TBDMS-dU structure
|
Common Name | 5'-O-TBDMS-dU | ||
|---|---|---|---|---|
| CAS Number | 76223-04-6 | Molecular Weight | 342.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26N2O5Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-O-TBDMS-dU5'-O-TBDMS-dU can be used in the synthesis of oligoribonucleotides[1]. |
| Name | 5'-O-(tert-butyldimethylsilyl)-2'-deoxyuridine |
|---|---|
| Synonym | More Synonyms |
| Description | 5'-O-TBDMS-dU can be used in the synthesis of oligoribonucleotides[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H26N2O5Si |
|---|---|
| Molecular Weight | 342.46300 |
| Exact Mass | 342.16100 |
| PSA | 93.55000 |
| LogP | 1.20680 |
| InChIKey | HCSHWGNMXQKRCF-DMDPSCGWSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2ccc(=O)[nH]c2=O)CC1O |
| 5'-O-tert-butyldimethylsilyl-2'-deoxyuridine |
| 2'-deoxy-5'-O-t-butyldimethylsilyluridine |