3-(Trimethoxysilyl)propyl benzoate structure
|
Common Name | 3-(Trimethoxysilyl)propyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 76241-02-6 | Molecular Weight | 284.380 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 315.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H20O5Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.3±18.7 °C | |
| Name | 3-trimethoxysilylpropyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.7±25.0 °C at 760 mmHg |
| Molecular Formula | C13H20O5Si |
| Molecular Weight | 284.380 |
| Flash Point | 120.3±18.7 °C |
| Exact Mass | 284.108002 |
| PSA | 53.99000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.480 |
| InChIKey | HYFWOBSAALCFRS-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCOC(=O)c1ccccc1)(OC)OC |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
|
~79%
3-(Trimethoxysi... CAS#:76241-02-6 |
| Literature: DOW CORNING TORAY CO., LTD. Patent: WO2005/103061 A1, 2005 ; Location in patent: Page/Page column 8 ; |
|
~58%
3-(Trimethoxysi... CAS#:76241-02-6 |
| Literature: Voronkov, M. G.; Frolov, Yu. L.; D'Yakov, V. M.; Chipanina, N. N.; Gubanova, L. I.; et al. Journal of Organometallic Chemistry, 1980 , vol. 201, # 1 p. 165 - 177 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| BENZOYLOXYPROPYLTRIMETHOXYSILANE |
| (3-benzoyloxypropyl)trimethoxysilane |
| 3-(Trimethoxysilyl)propyl benzoate |
| trimethoxysilylpropyl benzoate |
| 1-Propanol, 3-(trimethoxysilyl)-, benzoate |
| 1-Propanol,3-(trimethoxysilyl)-,benzoate (9CI) |
| 1-(trimethoxysilyl)propyl benzoate |
| 1-Propanol,3-(trimethoxysilyl)-,1-benzoate |