1-[1,2-bis(4-methoxyphenyl)butyl]-3-(3-methylphenyl)thiourea structure
|
Common Name | 1-[1,2-bis(4-methoxyphenyl)butyl]-3-(3-methylphenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 76289-18-4 | Molecular Weight | 434.59400 | |
| Density | 1.156g/cm3 | Boiling Point | 562.4ºC at 760 mmHg | |
| Molecular Formula | C26H30N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.9ºC | |
| Name | 1-[1,2-bis(4-methoxyphenyl)butyl]-3-(3-methylphenyl)thiourea |
|---|
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 562.4ºC at 760 mmHg |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.59400 |
| Flash Point | 293.9ºC |
| Exact Mass | 434.20300 |
| PSA | 74.61000 |
| LogP | 6.69760 |
| Index of Refraction | 1.622 |
| InChIKey | DLSCXXGQFLYPKL-UHFFFAOYSA-N |
| SMILES | CCC(c1ccc(OC)cc1)C(NC(=S)Nc1cccc(C)c1)c1ccc(OC)cc1 |
|
~81%
1-[1,2-bis(4-me... CAS#:76289-18-4 |
| Literature: Omar; Farghaly; Hazzai; Eshba; Sharabi; Daabees Journal of Pharmaceutical Sciences, 1981 , vol. 70, # 9 p. 1075 - 1079 |
|
~%
1-[1,2-bis(4-me... CAS#:76289-18-4 |
| Literature: Omar; Farghaly; Hazzai; Eshba; Sharabi; Daabees Journal of Pharmaceutical Sciences, 1981 , vol. 70, # 9 p. 1075 - 1079 |
|
~%
1-[1,2-bis(4-me... CAS#:76289-18-4 |
| Literature: Omar; Farghaly; Hazzai; Eshba; Sharabi; Daabees Journal of Pharmaceutical Sciences, 1981 , vol. 70, # 9 p. 1075 - 1079 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |