5-(4-chlorophenyl)-1,2-oxazole-3-carbaldehyde structure
|
Common Name | 5-(4-chlorophenyl)-1,2-oxazole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 763109-09-7 | Molecular Weight | 207.61300 | |
| Density | 1.345g/cm3 | Boiling Point | 387.9ºC at 760 mmHg | |
| Molecular Formula | C10H6ClNO2 | Melting Point | 136-140ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 188.4ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 5-(4-chlorophenyl)-1,2-oxazole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 387.9ºC at 760 mmHg |
| Melting Point | 136-140ºC(lit.) |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.61300 |
| Flash Point | 188.4ºC |
| Exact Mass | 207.00900 |
| PSA | 43.10000 |
| LogP | 2.80750 |
| Index of Refraction | 1.601 |
| InChIKey | TUGDVOPMQBYENX-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(-c2ccc(Cl)cc2)on1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H317-H319-H334-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36/37/38-42/43 |
| Safety Phrases | 26-36-45 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
|
~%
5-(4-chlorophen... CAS#:763109-09-7 |
| Literature: US2009/275594 A1, ; Page/Page column 28 ; |
|
~%
5-(4-chlorophen... CAS#:763109-09-7 |
| Literature: Archiv der Pharmazie, , vol. 345, # 5 p. 386 - 392 |
|
~%
5-(4-chlorophen... CAS#:763109-09-7 |
| Literature: Archiv der Pharmazie, , vol. 345, # 5 p. 386 - 392 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(4-Chlorophenyl)isoxazole-3-carboxaldehyde |
| 3-Isoxazolecarboxaldehyde,5-(4-chlorophenyl) |