3-chloro-4-dimethylamino-5-methyl-6-phenyl-pyran-2-one
Modify Date: 2025-09-20 16:27:11
3-chloro-4-dimethylamino-5-methyl-6-phenyl-pyran-2-one structure
|
Common Name | 3-chloro-4-dimethylamino-5-methyl-6-phenyl-pyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 76312-41-9 | Molecular Weight | 263.71900 | |
| Density | 1.25g/cm3 | Boiling Point | 342.5ºC at 760 mmHg | |
| Molecular Formula | C14H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.9ºC | |
| Name | 3-chloro-4-(dimethylamino)-5-methyl-6-phenylpyran-2-one |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 342.5ºC at 760 mmHg |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.71900 |
| Flash Point | 160.9ºC |
| Exact Mass | 263.07100 |
| PSA | 33.45000 |
| LogP | 3.33460 |
| Index of Refraction | 1.593 |
| InChIKey | ZUUVUZHSKQFRAZ-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccccc2)oc(=O)c(Cl)c1N(C)C |
|
~%
3-chloro-4-dime... CAS#:76312-41-9 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1201 - 1206 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |