2H-Pyran-2-one,3-chloro-5-methyl-4-(methylphenylamino)-6-phenyl- structure
|
Common Name | 2H-Pyran-2-one,3-chloro-5-methyl-4-(methylphenylamino)-6-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 76312-43-1 | Molecular Weight | 325.78900 | |
| Density | 1.28g/cm3 | Boiling Point | 423ºC at 760mmHg | |
| Molecular Formula | C19H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.6ºC | |
| Name | 3-chloro-5-methyl-4-(N-methylanilino)-6-phenylpyran-2-one |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 423ºC at 760mmHg |
| Molecular Formula | C19H16ClNO2 |
| Molecular Weight | 325.78900 |
| Flash Point | 209.6ºC |
| Exact Mass | 325.08700 |
| PSA | 33.45000 |
| LogP | 5.03650 |
| Index of Refraction | 1.641 |
| InChIKey | COKHEHBVLLNOAJ-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccccc2)oc(=O)c(Cl)c1N(C)c1ccccc1 |
|
~%
2H-Pyran-2-one,... CAS#:76312-43-1 |
| Literature: Bargagna, Alberto; Schenone, Pietro; Bondavalli, Francesco; Longobardi, Mario Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1201 - 1206 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |