ditert-butyl but-2-enedioate structure
|
Common Name | ditert-butyl but-2-enedioate | ||
|---|---|---|---|---|
| CAS Number | 7633-38-7 | Molecular Weight | 228.28500 | |
| Density | 1.004g/cm3 | Boiling Point | 273.2ºC at 760 mmHg | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.4ºC | |
| Name | ditert-butyl (E)-but-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 273.2ºC at 760 mmHg |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28500 |
| Flash Point | 123.4ºC |
| Exact Mass | 228.13600 |
| PSA | 52.60000 |
| LogP | 2.22600 |
| Index of Refraction | 1.45 |
| InChIKey | MSVGHYYKWDQHFV-BQYQJAHWSA-N |
| SMILES | CC(C)(C)OC(=O)C=CC(=O)OC(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917190090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| bis(tert-butoxycarbonyl)hydrazine |
| DI-TERT-BUTYL HYDRAZODICARBOXYLATE |
| tert-Butyl hydrazodiformate |
| N,N'-di-BOC-hydrazine |
| Di-tert-butyl hydrazodiformate |
| Di-tert.-butyl-fumarat |
| di-t-butyl hydrazodiformate |
| di-t-butyl fumarate |
| Di-tert-butyl bicarbamate |
| di-tert-butyl fumarate |
| tert-butyl fumarate |
| (tert-butoxy)-N-[(tert-butoxy)carbonylamino]carboxamide |
| di-tert-butyl maleate |
| ditert-butyl but-2-enedioate |